C16H34O4 — CID 11380742
5-[2-(5-hydroxy-3,3-dimethylpentoxy)ethoxy]-3,3-dimethylpentan-1-ol (PubChem CID 11380742) has the molecular formula C16H34O4 and a molecular weight of 290.44 g/mol. Its IUPAC name is 5-[2-(5-hydroxy-3,3-dimethylpentoxy)ethoxy]-3,3-dimethylpentan-1-ol.
| Compound Name | 5-[2-(5-hydroxy-3,3-dimethylpentoxy)ethoxy]-3,3-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 11380742 |
| Molecular Formula | C16H34O4 |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | 5-[2-(5-hydroxy-3,3-dimethylpentoxy)ethoxy]-3,3-dimethylpentan-1-ol |
| SMILES | CC(C)(CCO)CCOCCOCCC(C)(C)CCO |
| InChI | InChI=1S/C16H34O4/c1-15(2,5-9-17)7-11-19-13-14-20-12-8-16(3,4)6-10-18/h17-18H,5-14H2,1-4H3 |
| InChIKey | IDTLPVJEUPKDMH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|