C18H38O4 — CID 21303526
6-[2-(6-hydroxy-3,3-dimethylhexoxy)ethoxy]-4,4-dimethylhexan-1-ol (PubChem CID 21303526) has the molecular formula C18H38O4 and a molecular weight of 318.50 g/mol. Its IUPAC name is 6-[2-(6-hydroxy-3,3-dimethylhexoxy)ethoxy]-4,4-dimethylhexan-1-ol.
| Compound Name | 6-[2-(6-hydroxy-3,3-dimethylhexoxy)ethoxy]-4,4-dimethylhexan-1-ol |
|---|---|
| PubChem CID | 21303526 |
| Molecular Formula | C18H38O4 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.28 |
| IUPAC Name | 6-[2-(6-hydroxy-3,3-dimethylhexoxy)ethoxy]-4,4-dimethylhexan-1-ol |
| SMILES | CC(C)(CCCO)CCOCCOCCC(C)(C)CCCO |
| InChI | InChI=1S/C18H38O4/c1-17(2,7-5-11-19)9-13-21-15-16-22-14-10-18(3,4)8-6-12-20/h19-20H,5-16H2,1-4H3 |
| InChIKey | VCUKGHSSQKICDW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|