C24H34N4O4 — CID 59047326
ethyl 3-oxo-3-[4-(8-pyridin-4-yl-2,8-diazaspiro[4.5]decane-2-carbonyl)piperidin-1-yl]propanoate (PubChem CID 59047326) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is ethyl 3-oxo-3-[4-(8-pyridin-4-yl-2,8-diazaspiro[4.5]decane-2-carbonyl)piperidin-1-yl]propanoate.
| Compound Name | ethyl 3-oxo-3-[4-(8-pyridin-4-yl-2,8-diazaspiro[4.5]decane-2-carbonyl)piperidin-1-yl]propanoate |
|---|---|
| PubChem CID | 59047326 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | ethyl 3-oxo-3-[4-(8-pyridin-4-yl-2,8-diazaspiro[4.5]decane-2-carbonyl)piperidin-1-yl]propanoate |
| SMILES | CCOC(=O)CC(=O)N1CCC(C(=O)N2CCC3(CCN(c4ccncc4)CC3)C2)CC1 |
| InChI | InChI=1S/C24H34N4O4/c1-2-32-22(30)17-21(29)27-12-5-19(6-13-27)23(31)28-16-9-24(18-28)7-14-26(15-8-24)20-3-10-25-11-4-20/h3-4,10-11,19H,2,5-9,12-18H2,1H3 |
| InChIKey | FDARVNQMYLVUGL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|