C34H62O5 — CID 59048115
(6-dec-1-en-4-yloxy-6-oxohexyl) (Z)-12-hydroxyoctadec-9-enoate (PubChem CID 59048115) has the molecular formula C34H62O5 and a molecular weight of 550.87 g/mol. Its IUPAC name is (6-dec-1-en-4-yloxy-6-oxohexyl) (Z)-12-hydroxyoctadec-9-enoate.
| Compound Name | (6-dec-1-en-4-yloxy-6-oxohexyl) (Z)-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 59048115 |
| Molecular Formula | C34H62O5 |
| Molecular Weight | 550.87 g/mol |
| Exact Mass | 550.46 |
| IUPAC Name | (6-dec-1-en-4-yloxy-6-oxohexyl) (Z)-12-hydroxyoctadec-9-enoate |
| SMILES | C=CCC(CCCCCC)OC(=O)CCCCCOC(=O)CCCCCCC/C=C\CC(O)CCCCCC |
| InChI | InChI=1S/C34H62O5/c1-4-7-9-18-25-31(35)26-19-15-13-11-12-14-16-21-28-33(36)38-30-23-17-22-29-34(37)39-32(24-6-3)27-20-10-8-5-2/h6,15,19,31-32,35H,3-5,7-14,16-18,20-30H2,1-2H3/b19-15- |
| InChIKey | VZTMCRIEPJBVJU-CYVLTUHYSA-N |
| XLogP | 9.56 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.87 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|