C42H26MnN6O4S2 — CID 59049272
manganese(2+);methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-bis(1,3-thiazol-5-yl)porphyrin-22,24-diid-5-yl]benzoate (PubChem CID 59049272) has the molecular formula C42H26MnN6O4S2 and a molecular weight of 797.78 g/mol. Its IUPAC name is manganese(2+);methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-bis(1,3-thiazol-5-yl)porphyrin-22,24-diid-5-yl]benzoate.
| Compound Name | manganese(2+);methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-bis(1,3-thiazol-5-yl)porphyrin-22,24-diid-5-yl]benzoate |
|---|---|
| PubChem CID | 59049272 |
| Molecular Formula | C42H26MnN6O4S2 |
| Molecular Weight | 797.78 g/mol |
| Exact Mass | 797.08 |
| IUPAC Name | manganese(2+);methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-bis(1,3-thiazol-5-yl)porphyrin-22,24-diid-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2c3nc(c(-c4cncs4)c4ccc([n-]4)c(-c4ccc(C(=O)OC)cc4)c4nc(c(-c5cncs5)c5ccc2[n-]5)C=C4)C=C3)cc1.[Mn+2] |
| InChI | InChI=1S/C42H27N6O4S2.Mn/c1-51-41(49)25-7-3-23(4-8-25)37-27-11-15-31(45-27)39(35-19-43-21-53-35)33-17-13-29(47-33)38(24-5-9-26(10-6-24)42(50)52-2)30-14-18-34(48-30)40(36-20-44-22-54-36)32-16-12-28(37)46-32;/h3-22H,1-2H3,(H-,45,46,47,48,49,50);/q-1;+2/p-1/b37-27-,37-28-,38-29-,38-30-,39-31+,39-33+,40-32+,40-34+; |
| InChIKey | GWFOGGOWXVRBAH-DSASGDSRSA-M |
| XLogP | 9.07 |
| TPSA | 132.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.78 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |