C56H52N4O4S2Zn — CID 139261961
zinc methyl 4-[10,15-bis(5-hexylthiophen-2-yl)-20-(4-methoxycarbonylphenyl)porphyrin-22,24-diid-5-yl]benzoate (PubChem CID 139261961) has the molecular formula C56H52N4O4S2Zn and a molecular weight of 974.58 g/mol. Its IUPAC name is zinc methyl 4-[10,15-bis(5-hexylthiophen-2-yl)-20-(4-methoxycarbonylphenyl)porphyrin-22,24-diid-5-yl]benzoate.
| Compound Name | zinc methyl 4-[10,15-bis(5-hexylthiophen-2-yl)-20-(4-methoxycarbonylphenyl)porphyrin-22,24-diid-5-yl]benzoate |
|---|---|
| PubChem CID | 139261961 |
| Molecular Formula | C56H52N4O4S2Zn |
| Molecular Weight | 974.58 g/mol |
| Exact Mass | 972.27 |
| IUPAC Name | zinc methyl 4-[10,15-bis(5-hexylthiophen-2-yl)-20-(4-methoxycarbonylphenyl)porphyrin-22,24-diid-5-yl]benzoate |
| SMILES | CCCCCCc1ccc(-c2c3nc(c(-c4ccc(CCCCCC)s4)c4ccc([n-]4)c(-c4ccc(C(=O)OC)cc4)c4nc(c(-c5ccc(C(=O)OC)cc5)c5ccc2[n-]5)C=C4)C=C3)s1.[Zn+2] |
| InChI | InChI=1S/C56H53N4O4S2.Zn/c1-5-7-9-11-13-39-23-33-49(65-39)53-45-29-27-43(58-45)51(35-15-19-37(20-16-35)55(61)63-3)41-25-26-42(57-41)52(36-17-21-38(22-18-36)56(62)64-4)44-28-30-46(59-44)54(48-32-31-47(53)60-48)50-34-24-40(66-50)14-12-10-8-6-2;/h15-34H,5-14H2,1-4H3,(H-,57,58,59,60,61,62);/q-1;+2/p-1/b51-41-,51-43-,52-42-,52-44-,53-45+,53-47+,54-46+,54-48+; |
| InChIKey | OKZRXMKVALWPMB-ONQNBMPDSA-M |
| XLogP | 14.52 |
| TPSA | 106.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 974.58 |
| LogP ≤ 5 | 14.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|