C56H54N4O4S2 — CID 139261962
methyl 4-[15,20-bis(5-hexylthiophen-2-yl)-10-(4-methoxycarbonylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate (PubChem CID 139261962) has the molecular formula C56H54N4O4S2 and a molecular weight of 911.21 g/mol. Its IUPAC name is methyl 4-[15,20-bis(5-hexylthiophen-2-yl)-10-(4-methoxycarbonylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate.
| Compound Name | methyl 4-[15,20-bis(5-hexylthiophen-2-yl)-10-(4-methoxycarbonylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 139261962 |
| Molecular Formula | C56H54N4O4S2 |
| Molecular Weight | 911.21 g/mol |
| Exact Mass | 910.36 |
| IUPAC Name | methyl 4-[15,20-bis(5-hexylthiophen-2-yl)-10-(4-methoxycarbonylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate |
| SMILES | CCCCCCc1ccc(-c2c3nc(c(-c4ccc(CCCCCC)s4)c4ccc([nH]4)c(-c4ccc(C(=O)OC)cc4)c4nc(c(-c5ccc(C(=O)OC)cc5)c5ccc2[nH]5)C=C4)C=C3)s1 |
| InChI | InChI=1S/C56H54N4O4S2/c1-5-7-9-11-13-39-23-33-49(65-39)53-45-29-27-43(58-45)51(35-15-19-37(20-16-35)55(61)63-3)41-25-26-42(57-41)52(36-17-21-38(22-18-36)56(62)64-4)44-28-30-46(59-44)54(48-32-31-47(53)60-48)50-34-24-40(66-50)14-12-10-8-6-2/h15-34,58-59H,5-14H2,1-4H3/b51-41-,51-43-,52-42-,52-44-,53-45+,53-47+,54-46+,54-48+ |
| InChIKey | GPHVDZNTTDEKMV-JPWQKZHBSA-N |
| XLogP | 15.27 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.21 |
| LogP ≤ 5 | 15.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|