C13H13INO3Y- — CID 59049769
ethyl 4-hydroxy-8-iodo-1-methyl-4,6-dihydroquinolin-6-ide-3-carboxylate;yttrium (PubChem CID 59049769) has the molecular formula C13H13INO3Y- and a molecular weight of 447.06 g/mol. Its IUPAC name is ethyl 4-hydroxy-8-iodo-1-methyl-4,6-dihydroquinolin-6-ide-3-carboxylate;yttrium.
| Compound Name | ethyl 4-hydroxy-8-iodo-1-methyl-4,6-dihydroquinolin-6-ide-3-carboxylate;yttrium |
|---|---|
| PubChem CID | 59049769 |
| Molecular Formula | C13H13INO3Y- |
| Molecular Weight | 447.06 g/mol |
| Exact Mass | 446.90 |
| IUPAC Name | ethyl 4-hydroxy-8-iodo-1-methyl-4,6-dihydroquinolin-6-ide-3-carboxylate;yttrium |
| SMILES | CCOC(=O)C1=CN(C)c2c(I)c[c-]cc2C1O.[Y] |
| InChI | InChI=1S/C13H13INO3.Y/c1-3-18-13(17)9-7-15(2)11-8(12(9)16)5-4-6-10(11)14;/h5-7,12,16H,3H2,1-2H3;/q-1; |
| InChIKey | QOTFNJXXRNSUTH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.06 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|