C19H24O5 — CID 134982932
diethyl 6-tert-butyl-3-hydroxy-3H-indene-1,2-dicarboxylate (PubChem CID 134982932) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is diethyl 6-tert-butyl-3-hydroxy-3H-indene-1,2-dicarboxylate.
| Compound Name | diethyl 6-tert-butyl-3-hydroxy-3H-indene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134982932 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | diethyl 6-tert-butyl-3-hydroxy-3H-indene-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)C(O)c2ccc(C(C)(C)C)cc21 |
| InChI | InChI=1S/C19H24O5/c1-6-23-17(21)14-13-10-11(19(3,4)5)8-9-12(13)16(20)15(14)18(22)24-7-2/h8-10,16,20H,6-7H2,1-5H3 |
| InChIKey | OASVIEKQEJHLBX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |