C29H30N4O4 — CID 59052511
N-[(2S)-1-[[cyano(3-phenylpropyl)amino]-methylamino]-1-oxo-3-phenylpropan-2-yl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 59052511) has the molecular formula C29H30N4O4 and a molecular weight of 498.58 g/mol. Its IUPAC name is N-[(2S)-1-[[cyano(3-phenylpropyl)amino]-methylamino]-1-oxo-3-phenylpropan-2-yl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-[(2S)-1-[[cyano(3-phenylpropyl)amino]-methylamino]-1-oxo-3-phenylpropan-2-yl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 59052511 |
| Molecular Formula | C29H30N4O4 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | N-[(2S)-1-[[cyano(3-phenylpropyl)amino]-methylamino]-1-oxo-3-phenylpropan-2-yl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | CN(C(=O)[C@H](Cc1ccccc1)NC(=O)c1ccc2c(c1)OCCO2)N(C#N)CCCc1ccccc1 |
| InChI | InChI=1S/C29H30N4O4/c1-32(33(21-30)16-8-13-22-9-4-2-5-10-22)29(35)25(19-23-11-6-3-7-12-23)31-28(34)24-14-15-26-27(20-24)37-18-17-36-26/h2-7,9-12,14-15,20,25H,8,13,16-19H2,1H3,(H,31,34)/t25-/m0/s1 |
| InChIKey | CZTSNSSQZSVLLK-VWLOTQADSA-N |
| XLogP | 3.59 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|