C19H22N2O4 — CID 59053957
1-[2-(methoxyamino)phenyl]-7-propanoyl-3-oxa-8-azatetracyclo[6.2.1.02,5.06,10]undecan-11-one (PubChem CID 59053957) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-[2-(methoxyamino)phenyl]-7-propanoyl-3-oxa-8-azatetracyclo[6.2.1.02,5.06,10]undecan-11-one.
| Compound Name | 1-[2-(methoxyamino)phenyl]-7-propanoyl-3-oxa-8-azatetracyclo[6.2.1.02,5.06,10]undecan-11-one |
|---|---|
| PubChem CID | 59053957 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 1-[2-(methoxyamino)phenyl]-7-propanoyl-3-oxa-8-azatetracyclo[6.2.1.02,5.06,10]undecan-11-one |
| SMILES | CCC(=O)C1C2C3COC3C3(c4ccccc4NOC)C(=O)N1CC23 |
| InChI | InChI=1S/C19H22N2O4/c1-3-14(22)16-15-10-9-25-17(10)19(12(15)8-21(16)18(19)23)11-6-4-5-7-13(11)20-24-2/h4-7,10,12,15-17,20H,3,8-9H2,1-2H3 |
| InChIKey | NAURBKKZMHINOX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|