C13H15N3O3 — CID 164939888
(3aR,6aS)-5-[2-(methoxyamino)phenyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione (PubChem CID 164939888) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is (3aR,6aS)-5-[2-(methoxyamino)phenyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione.
| Compound Name | (3aR,6aS)-5-[2-(methoxyamino)phenyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 164939888 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | (3aR,6aS)-5-[2-(methoxyamino)phenyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione |
| SMILES | CONc1ccccc1N1C[C@@H]2C(=O)NC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C13H15N3O3/c1-19-15-10-4-2-3-5-11(10)16-6-8-9(7-16)13(18)14-12(8)17/h2-5,8-9,15H,6-7H2,1H3,(H,14,17,18)/t8-,9+ |
| InChIKey | YHELMASUDDVAOD-DTORHVGOSA-N |
| XLogP | 0.37 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|