C26H52N6O4 — CID 59054802
(2S)-2-[[(2R)-2-[[2-(4,7,10-triethyl-1,4,7,10-tetrazacyclododec-1-yl)acetyl]amino]pentanoyl]amino]pentanoic acid (PubChem CID 59054802) has the molecular formula C26H52N6O4 and a molecular weight of 512.74 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-[[2-(4,7,10-triethyl-1,4,7,10-tetrazacyclododec-1-yl)acetyl]amino]pentanoyl]amino]pentanoic acid.
| Compound Name | (2S)-2-[[(2R)-2-[[2-(4,7,10-triethyl-1,4,7,10-tetrazacyclododec-1-yl)acetyl]amino]pentanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 59054802 |
| Molecular Formula | C26H52N6O4 |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.41 |
| IUPAC Name | (2S)-2-[[(2R)-2-[[2-(4,7,10-triethyl-1,4,7,10-tetrazacyclododec-1-yl)acetyl]amino]pentanoyl]amino]pentanoic acid |
| SMILES | CCC[C@H](NC(=O)[C@@H](CCC)NC(=O)CN1CCN(CC)CCN(CC)CCN(CC)CC1)C(=O)O |
| InChI | InChI=1S/C26H52N6O4/c1-6-11-22(25(34)28-23(12-7-2)26(35)36)27-24(33)21-32-19-17-30(9-4)15-13-29(8-3)14-16-31(10-5)18-20-32/h22-23H,6-21H2,1-5H3,(H,27,33)(H,28,34)(H,35,36)/t22-,23+/m1/s1 |
| InChIKey | AFHLIWCNVUPPPL-PKTZIBPZSA-N |
| XLogP | 0.92 |
| TPSA | 108.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |