C16H24O5 — CID 59054888
ethyl (E)-4-[(3'aR,7'aS)-spiro[1,3-dioxolane-2,5'-3,3a,4,6,7,7a-hexahydro-2H-1-benzofuran]-2'-yl]but-2-enoate (PubChem CID 59054888) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is ethyl (E)-4-[(3'aR,7'aS)-spiro[1,3-dioxolane-2,5'-3,3a,4,6,7,7a-hexahydro-2H-1-benzofuran]-2'-yl]but-2-enoate.
| Compound Name | ethyl (E)-4-[(3'aR,7'aS)-spiro[1,3-dioxolane-2,5'-3,3a,4,6,7,7a-hexahydro-2H-1-benzofuran]-2'-yl]but-2-enoate |
|---|---|
| PubChem CID | 59054888 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | ethyl (E)-4-[(3'aR,7'aS)-spiro[1,3-dioxolane-2,5'-3,3a,4,6,7,7a-hexahydro-2H-1-benzofuran]-2'-yl]but-2-enoate |
| SMILES | CCOC(=O)/C=C/CC1C[C@@H]2CC3(CC[C@@H]2O1)OCCO3 |
| InChI | InChI=1S/C16H24O5/c1-2-18-15(17)5-3-4-13-10-12-11-16(19-8-9-20-16)7-6-14(12)21-13/h3,5,12-14H,2,4,6-11H2,1H3/b5-3+/t12-,13?,14+/m1/s1 |
| InChIKey | QIFDTRJVNZADJP-JJGFAXIRSA-N |
| XLogP | 2.20 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|