C27H46O3 — CID 59054911
trans-(1R,3S,5Z)-5-[(E)-4-[(1S,3S)-3-(4-ethyl-4-hydroxyhexyl)-1,2,2-trimethylcyclopentyl]but-2-enylidene]-4-methylidenecyclohexane-1,3-diol (PubChem CID 59054911) has the molecular formula C27H46O3 and a molecular weight of 418.66 g/mol. Its IUPAC name is trans-(1R,3S,5Z)-5-[(E)-4-[(1S,3S)-3-(4-ethyl-4-hydroxyhexyl)-1,2,2-trimethylcyclopentyl]but-2-enylidene]-4-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1R,3S,5Z)-5-[(E)-4-[(1S,3S)-3-(4-ethyl-4-hydroxyhexyl)-1,2,2-trimethylcyclopentyl]but-2-enylidene]-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 59054911 |
| Molecular Formula | C27H46O3 |
| Molecular Weight | 418.66 g/mol |
| Exact Mass | 418.34 |
| IUPAC Name | trans-(1R,3S,5Z)-5-[(E)-4-[(1S,3S)-3-(4-ethyl-4-hydroxyhexyl)-1,2,2-trimethylcyclopentyl]but-2-enylidene]-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1/C(=C\C=C\C[C@]2(C)CC[C@H](CCCC(O)(CC)CC)C2(C)C)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C27H46O3/c1-7-27(30,8-2)16-11-13-22-14-17-26(6,25(22,4)5)15-10-9-12-21-18-23(28)19-24(29)20(21)3/h9-10,12,22-24,28-30H,3,7-8,11,13-19H2,1-2,4-6H3/b10-9+,21-12-/t22-,23+,24-,26+/m0/s1 |
| InChIKey | PGTTTZVBFVXREC-JTUWEEPMSA-N |
| XLogP | 6.09 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.66 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |