C24H31BrClNO3 — CID 59065554
(5R)-5-[4-(5-bromopentoxy)phenyl]-9-chloro-7,8-dimethoxy-3-methyl-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 59065554) has the molecular formula C24H31BrClNO3 and a molecular weight of 496.87 g/mol. Its IUPAC name is (5R)-5-[4-(5-bromopentoxy)phenyl]-9-chloro-7,8-dimethoxy-3-methyl-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | (5R)-5-[4-(5-bromopentoxy)phenyl]-9-chloro-7,8-dimethoxy-3-methyl-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 59065554 |
| Molecular Formula | C24H31BrClNO3 |
| Molecular Weight | 496.87 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | (5R)-5-[4-(5-bromopentoxy)phenyl]-9-chloro-7,8-dimethoxy-3-methyl-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | COc1cc2c(c(Cl)c1OC)CCN(C)C[C@@H]2c1ccc(OCCCCCBr)cc1 |
| InChI | InChI=1S/C24H31BrClNO3/c1-27-13-11-19-20(15-22(28-2)24(29-3)23(19)26)21(16-27)17-7-9-18(10-8-17)30-14-6-4-5-12-25/h7-10,15,21H,4-6,11-14,16H2,1-3H3/t21-/m1/s1 |
| InChIKey | JLUCCEWWKFMVHI-OAQYLSRUSA-N |
| XLogP | 5.92 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.87 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|