C42H50Cl2N2O5 — CID 142007912
9-chloro-5-[4-[4-[4-(9-chloro-7,8-dimethoxy-3-methyl-1,2,4,5-tetrahydro-3-benzazepin-5-yl)phenoxy]butoxy]phenyl]-7-methoxy-3,8-dimethyl-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 142007912) has the molecular formula C42H50Cl2N2O5 and a molecular weight of 733.78 g/mol. Its IUPAC name is 9-chloro-5-[4-[4-[4-(9-chloro-7,8-dimethoxy-3-methyl-1,2,4,5-tetrahydro-3-benzazepin-5-yl)phenoxy]butoxy]phenyl]-7-methoxy-3,8-dimethyl-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | 9-chloro-5-[4-[4-[4-(9-chloro-7,8-dimethoxy-3-methyl-1,2,4,5-tetrahydro-3-benzazepin-5-yl)phenoxy]butoxy]phenyl]-7-methoxy-3,8-dimethyl-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 142007912 |
| Molecular Formula | C42H50Cl2N2O5 |
| Molecular Weight | 733.78 g/mol |
| Exact Mass | 732.31 |
| IUPAC Name | 9-chloro-5-[4-[4-[4-(9-chloro-7,8-dimethoxy-3-methyl-1,2,4,5-tetrahydro-3-benzazepin-5-yl)phenoxy]butoxy]phenyl]-7-methoxy-3,8-dimethyl-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | COc1cc2c(c(Cl)c1C)CCN(C)CC2c1ccc(OCCCCOc2ccc(C3CN(C)CCc4c3cc(OC)c(OC)c4Cl)cc2)cc1 |
| InChI | InChI=1S/C42H50Cl2N2O5/c1-27-38(47-4)23-34-32(40(27)43)17-19-45(2)25-36(34)28-9-13-30(14-10-28)50-21-7-8-22-51-31-15-11-29(12-16-31)37-26-46(3)20-18-33-35(37)24-39(48-5)42(49-6)41(33)44/h9-16,23-24,36-37H,7-8,17-22,25-26H2,1-6H3 |
| InChIKey | RWSJQXVICJTJKC-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 52.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.78 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|