C38H43ClN2O3 — CID 142007903
(5R)-3-[5-[4-[(5R)-9-chloro-8-hydroxy-2,3,4,5-tetrahydro-1H-3-benzazepin-5-yl]phenoxy]pentyl]-9-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-8-ol (PubChem CID 142007903) has the molecular formula C38H43ClN2O3 and a molecular weight of 611.23 g/mol. Its IUPAC name is (5R)-3-[5-[4-[(5R)-9-chloro-8-hydroxy-2,3,4,5-tetrahydro-1H-3-benzazepin-5-yl]phenoxy]pentyl]-9-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-8-ol.
| Compound Name | (5R)-3-[5-[4-[(5R)-9-chloro-8-hydroxy-2,3,4,5-tetrahydro-1H-3-benzazepin-5-yl]phenoxy]pentyl]-9-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-8-ol |
|---|---|
| PubChem CID | 142007903 |
| Molecular Formula | C38H43ClN2O3 |
| Molecular Weight | 611.23 g/mol |
| Exact Mass | 610.30 |
| IUPAC Name | (5R)-3-[5-[4-[(5R)-9-chloro-8-hydroxy-2,3,4,5-tetrahydro-1H-3-benzazepin-5-yl]phenoxy]pentyl]-9-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-8-ol |
| SMILES | Cc1c(O)ccc2c1CCN(CCCCCOc1ccc([C@H]3CNCCc4c3ccc(O)c4Cl)cc1)C[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C38H43ClN2O3/c1-26-30-19-22-41(25-35(27-8-4-2-5-9-27)31(30)14-16-36(26)42)21-6-3-7-23-44-29-12-10-28(11-13-29)34-24-40-20-18-33-32(34)15-17-37(43)38(33)39/h2,4-5,8-17,34-35,40,42-43H,3,6-7,18-25H2,1H3/t34-,35-/m1/s1 |
| InChIKey | YLRBZNWEEFAPJU-VSJLXWSYSA-N |
| XLogP | 7.58 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.23 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|