C25H26ClN3O2S — CID 59066666
(E)-3-[3-chloro-4-(1-methylindol-5-yl)sulfanylphenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide (PubChem CID 59066666) has the molecular formula C25H26ClN3O2S and a molecular weight of 468.02 g/mol. Its IUPAC name is (E)-3-[3-chloro-4-(1-methylindol-5-yl)sulfanylphenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide.
| Compound Name | (E)-3-[3-chloro-4-(1-methylindol-5-yl)sulfanylphenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 59066666 |
| Molecular Formula | C25H26ClN3O2S |
| Molecular Weight | 468.02 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | (E)-3-[3-chloro-4-(1-methylindol-5-yl)sulfanylphenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide |
| SMILES | Cn1ccc2cc(Sc3ccc(/C=C/C(=O)NCCCN4CCCC4=O)cc3Cl)ccc21 |
| InChI | InChI=1S/C25H26ClN3O2S/c1-28-15-11-19-17-20(7-8-22(19)28)32-23-9-5-18(16-21(23)26)6-10-24(30)27-12-3-14-29-13-2-4-25(29)31/h5-11,15-17H,2-4,12-14H2,1H3,(H,27,30)/b10-6+ |
| InChIKey | IPHUCMMAPYGZGA-UXBLZVDNSA-N |
| XLogP | 5.12 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.02 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|