C25H26ClN3O2 — CID 91607567
3-[3-chloro-2-(1-methylindol-5-yl)phenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide (PubChem CID 91607567) has the molecular formula C25H26ClN3O2 and a molecular weight of 435.96 g/mol. Its IUPAC name is 3-[3-chloro-2-(1-methylindol-5-yl)phenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide.
| Compound Name | 3-[3-chloro-2-(1-methylindol-5-yl)phenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 91607567 |
| Molecular Formula | C25H26ClN3O2 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 3-[3-chloro-2-(1-methylindol-5-yl)phenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide |
| SMILES | Cn1ccc2cc(-c3c(Cl)cccc3C=CC(=O)NCCCN3CCCC3=O)ccc21 |
| InChI | InChI=1S/C25H26ClN3O2/c1-28-16-12-19-17-20(8-10-22(19)28)25-18(5-2-6-21(25)26)9-11-23(30)27-13-4-15-29-14-3-7-24(29)31/h2,5-6,8-12,16-17H,3-4,7,13-15H2,1H3,(H,27,30) |
| InChIKey | VDZCAPHBHDFAKU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|