C23H24ClFN2O2S — CID 76585397
3-[2-chloro-4-(4-fluorophenyl)sulfanyl-5-methylphenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide (PubChem CID 76585397) has the molecular formula C23H24ClFN2O2S and a molecular weight of 446.98 g/mol. Its IUPAC name is 3-[2-chloro-4-(4-fluorophenyl)sulfanyl-5-methylphenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide.
| Compound Name | 3-[2-chloro-4-(4-fluorophenyl)sulfanyl-5-methylphenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 76585397 |
| Molecular Formula | C23H24ClFN2O2S |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 3-[2-chloro-4-(4-fluorophenyl)sulfanyl-5-methylphenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide |
| SMILES | Cc1cc(C=CC(=O)NCCCN2CCCC2=O)c(Cl)cc1Sc1ccc(F)cc1 |
| InChI | InChI=1S/C23H24ClFN2O2S/c1-16-14-17(20(24)15-21(16)30-19-8-6-18(25)7-9-19)5-10-22(28)26-11-3-13-27-12-2-4-23(27)29/h5-10,14-15H,2-4,11-13H2,1H3,(H,26,28) |
| InChIKey | WCJPNDSPVMOCBM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|