C33H45NO8 — CID 59070856
1-O-[(2S,6S)-4-methyl-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-pent-4-enyl 2-hydroxy-2-(4-hydroxy-4-methylpentyl)butanedioate (PubChem CID 59070856) has the molecular formula C33H45NO8 and a molecular weight of 583.72 g/mol. Its IUPAC name is 1-O-[(2S,6S)-4-methyl-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-pent-4-enyl 2-hydroxy-2-(4-hydroxy-4-methylpentyl)butanedioate.
| Compound Name | 1-O-[(2S,6S)-4-methyl-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-pent-4-enyl 2-hydroxy-2-(4-hydroxy-4-methylpentyl)butanedioate |
|---|---|
| PubChem CID | 59070856 |
| Molecular Formula | C33H45NO8 |
| Molecular Weight | 583.72 g/mol |
| Exact Mass | 583.31 |
| IUPAC Name | 1-O-[(2S,6S)-4-methyl-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-pent-4-enyl 2-hydroxy-2-(4-hydroxy-4-methylpentyl)butanedioate |
| SMILES | C=CCCCOC(=O)CC(O)(CCCC(C)(C)O)C(=O)OC1C(C)=C[C@]23CCCN2CCc2cc4c(cc2[C@H]13)OCO4 |
| InChI | InChI=1S/C33H45NO8/c1-5-6-7-16-39-27(35)20-33(38,13-8-11-31(3,4)37)30(36)42-29-22(2)19-32-12-9-14-34(32)15-10-23-17-25-26(41-21-40-25)18-24(23)28(29)32/h5,17-19,28-29,37-38H,1,6-16,20-21H2,2-4H3/t28-,29?,32+,33?/m1/s1 |
| InChIKey | ISWLNEQWDBAESJ-DALNYJEGSA-N |
| XLogP | 4.33 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.72 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|