C28H37NO6 — CID 91194643
[(2S)-4-methyl-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] (2R)-2-ethenyl-2,6-dihydroxy-6-methylheptanoate (PubChem CID 91194643) has the molecular formula C28H37NO6 and a molecular weight of 483.61 g/mol. Its IUPAC name is [(2S)-4-methyl-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] (2R)-2-ethenyl-2,6-dihydroxy-6-methylheptanoate.
| Compound Name | [(2S)-4-methyl-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] (2R)-2-ethenyl-2,6-dihydroxy-6-methylheptanoate |
|---|---|
| PubChem CID | 91194643 |
| Molecular Formula | C28H37NO6 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | [(2S)-4-methyl-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] (2R)-2-ethenyl-2,6-dihydroxy-6-methylheptanoate |
| SMILES | C=C[C@](O)(CCCC(C)(C)O)C(=O)OC1C(C)=CC23CCCN2CCc2cc4c(cc2[C@H]13)OCO4 |
| InChI | InChI=1S/C28H37NO6/c1-5-28(32,11-6-9-26(3,4)31)25(30)35-24-18(2)16-27-10-7-12-29(27)13-8-19-14-21-22(34-17-33-21)15-20(19)23(24)27/h5,14-16,23-24,31-32H,1,6-13,17H2,2-4H3/t23-,24?,27?,28+/m1/s1 |
| InChIKey | DRZGQGQCBHDZHU-MMPZPBDWSA-N |
| XLogP | 3.62 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|