C31H43NO8 — CID 91547664
1-O-[(2S)-4-methyl-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-propan-2-yl (2R)-2-hydroxy-2-(4-hydroxy-4-methylpentyl)butanedioate (PubChem CID 91547664) has the molecular formula C31H43NO8 and a molecular weight of 557.68 g/mol. Its IUPAC name is 1-O-[(2S)-4-methyl-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-propan-2-yl (2R)-2-hydroxy-2-(4-hydroxy-4-methylpentyl)butanedioate.
| Compound Name | 1-O-[(2S)-4-methyl-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-propan-2-yl (2R)-2-hydroxy-2-(4-hydroxy-4-methylpentyl)butanedioate |
|---|---|
| PubChem CID | 91547664 |
| Molecular Formula | C31H43NO8 |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.30 |
| IUPAC Name | 1-O-[(2S)-4-methyl-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-propan-2-yl (2R)-2-hydroxy-2-(4-hydroxy-4-methylpentyl)butanedioate |
| SMILES | CC1=CC23CCCN2CCc2cc4c(cc2[C@@H]3C1OC(=O)[C@@](O)(CCCC(C)(C)O)CC(=O)OC(C)C)OCO4 |
| InChI | InChI=1S/C31H43NO8/c1-19(2)39-25(33)17-31(36,11-6-9-29(4,5)35)28(34)40-27-20(3)16-30-10-7-12-32(30)13-8-21-14-23-24(38-18-37-23)15-22(21)26(27)30/h14-16,19,26-27,35-36H,6-13,17-18H2,1-5H3/t26-,27?,30?,31-/m1/s1 |
| InChIKey | QSRYYOOGCBIXFD-KDLMOJTBSA-N |
| XLogP | 3.78 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|