C35H37NO8 — CID 59072491
3-O-(4-benzoylphenyl) 1-O-(oxiran-2-ylmethyl) 5-O-(1-phenylethylideneamino) 1-methylheptane-1,3,5-tricarboxylate (PubChem CID 59072491) has the molecular formula C35H37NO8 and a molecular weight of 599.68 g/mol. Its IUPAC name is 3-O-(4-benzoylphenyl) 1-O-(oxiran-2-ylmethyl) 5-O-(1-phenylethylideneamino) 1-methylheptane-1,3,5-tricarboxylate.
| Compound Name | 3-O-(4-benzoylphenyl) 1-O-(oxiran-2-ylmethyl) 5-O-(1-phenylethylideneamino) 1-methylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 59072491 |
| Molecular Formula | C35H37NO8 |
| Molecular Weight | 599.68 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | 3-O-(4-benzoylphenyl) 1-O-(oxiran-2-ylmethyl) 5-O-(1-phenylethylideneamino) 1-methylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(CC(CC(C)C(=O)OCC1CO1)C(=O)Oc1ccc(C(=O)c2ccccc2)cc1)C(=O)ON=C(C)c1ccccc1 |
| InChI | InChI=1S/C35H37NO8/c1-4-25(35(40)44-36-24(3)26-11-7-5-8-12-26)20-29(19-23(2)33(38)42-22-31-21-41-31)34(39)43-30-17-15-28(16-18-30)32(37)27-13-9-6-10-14-27/h5-18,23,25,29,31H,4,19-22H2,1-3H3 |
| InChIKey | DWKKQRATMXTIDE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 120.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.68 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|