C51H50F8N2O10 — CID 135132466
1-O-[4-[(2E)-2-benzoyloxyimino-3-ethylheptanoyl]phenyl] 6-O-[4-[(2E)-2-benzoyloxyimino-3-ethyloctanoyl]phenyl] 2,2,3,3,4,4,5,5-octafluorohexanedioate (PubChem CID 135132466) has the molecular formula C51H50F8N2O10 and a molecular weight of 1002.95 g/mol. Its IUPAC name is 1-O-[4-[(2E)-2-benzoyloxyimino-3-ethylheptanoyl]phenyl] 6-O-[4-[(2E)-2-benzoyloxyimino-3-ethyloctanoyl]phenyl] 2,2,3,3,4,4,5,5-octafluorohexanedioate.
| Compound Name | 1-O-[4-[(2E)-2-benzoyloxyimino-3-ethylheptanoyl]phenyl] 6-O-[4-[(2E)-2-benzoyloxyimino-3-ethyloctanoyl]phenyl] 2,2,3,3,4,4,5,5-octafluorohexanedioate |
|---|---|
| PubChem CID | 135132466 |
| Molecular Formula | C51H50F8N2O10 |
| Molecular Weight | 1002.95 g/mol |
| Exact Mass | 1002.33 |
| IUPAC Name | 1-O-[4-[(2E)-2-benzoyloxyimino-3-ethylheptanoyl]phenyl] 6-O-[4-[(2E)-2-benzoyloxyimino-3-ethyloctanoyl]phenyl] 2,2,3,3,4,4,5,5-octafluorohexanedioate |
| SMILES | CCCCCC(CC)/C(=N\OC(=O)c1ccccc1)C(=O)c1ccc(OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)Oc2ccc(C(=O)/C(=N/OC(=O)c3ccccc3)C(CC)CCCC)cc2)cc1 |
| InChI | InChI=1S/C51H50F8N2O10/c1-5-9-13-19-33(8-4)41(61-71-45(65)37-22-16-12-17-23-37)43(63)35-26-30-39(31-27-35)69-47(67)49(54,55)51(58,59)50(56,57)48(52,53)46(66)68-38-28-24-34(25-29-38)42(62)40(32(7-3)18-10-6-2)60-70-44(64)36-20-14-11-15-21-36/h11-12,14-17,20-33H,5-10,13,18-19H2,1-4H3/b60-40+,61-41+ |
| InChIKey | DFTBLKKQUTWQRV-YISSXXFUSA-N |
| XLogP | 12.35 |
| TPSA | 164.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 71 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1002.95 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|