C51H64N2O8 — CID 135137297
[(E)-[3-ethyl-1-[4-[6-[4-[(2E)-3-ethyl-2-[hydroxy(phenyl)methoxy]iminooctanoyl]phenoxy]hexoxy]phenyl]-1-oxoheptan-2-ylidene]amino] benzoate (PubChem CID 135137297) has the molecular formula C51H64N2O8 and a molecular weight of 833.08 g/mol. Its IUPAC name is [(E)-[3-ethyl-1-[4-[6-[4-[(2E)-3-ethyl-2-[hydroxy(phenyl)methoxy]iminooctanoyl]phenoxy]hexoxy]phenyl]-1-oxoheptan-2-ylidene]amino] benzoate.
| Compound Name | [(E)-[3-ethyl-1-[4-[6-[4-[(2E)-3-ethyl-2-[hydroxy(phenyl)methoxy]iminooctanoyl]phenoxy]hexoxy]phenyl]-1-oxoheptan-2-ylidene]amino] benzoate |
|---|---|
| PubChem CID | 135137297 |
| Molecular Formula | C51H64N2O8 |
| Molecular Weight | 833.08 g/mol |
| Exact Mass | 832.47 |
| IUPAC Name | [(E)-[3-ethyl-1-[4-[6-[4-[(2E)-3-ethyl-2-[hydroxy(phenyl)methoxy]iminooctanoyl]phenoxy]hexoxy]phenyl]-1-oxoheptan-2-ylidene]amino] benzoate |
| SMILES | CCCCCC(CC)/C(=N\OC(O)c1ccccc1)C(=O)c1ccc(OCCCCCCOc2ccc(C(=O)/C(=N/OC(=O)c3ccccc3)C(CC)CCCC)cc2)cc1 |
| InChI | InChI=1S/C51H64N2O8/c1-5-9-15-23-39(8-4)47(53-61-51(57)43-26-18-14-19-27-43)49(55)41-30-34-45(35-31-41)59-37-21-12-11-20-36-58-44-32-28-40(29-33-44)48(54)46(38(7-3)22-10-6-2)52-60-50(56)42-24-16-13-17-25-42/h13-14,16-19,24-35,38-39,51,57H,5-12,15,20-23,36-37H2,1-4H3/b52-46+,53-47+ |
| InChIKey | MBAYVMOLNYMIJM-HXCKQWCNSA-N |
| XLogP | 12.17 |
| TPSA | 133.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.08 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|