C30H40N4O3S — CID 59073313
3-[(2E)-2-[(E)-3-(7-hexyl-3,3-dimethylpyrrolo[2,3-b]pyridin-7-ium-2-yl)prop-2-enylidene]-3,3-dimethylpyrrolo[2,3-b]pyridin-1-yl]propane-1-sulfonate (PubChem CID 59073313) has the molecular formula C30H40N4O3S and a molecular weight of 536.74 g/mol. Its IUPAC name is 3-[(2E)-2-[(E)-3-(7-hexyl-3,3-dimethylpyrrolo[2,3-b]pyridin-7-ium-2-yl)prop-2-enylidene]-3,3-dimethylpyrrolo[2,3-b]pyridin-1-yl]propane-1-sulfonate.
| Compound Name | 3-[(2E)-2-[(E)-3-(7-hexyl-3,3-dimethylpyrrolo[2,3-b]pyridin-7-ium-2-yl)prop-2-enylidene]-3,3-dimethylpyrrolo[2,3-b]pyridin-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 59073313 |
| Molecular Formula | C30H40N4O3S |
| Molecular Weight | 536.74 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | 3-[(2E)-2-[(E)-3-(7-hexyl-3,3-dimethylpyrrolo[2,3-b]pyridin-7-ium-2-yl)prop-2-enylidene]-3,3-dimethylpyrrolo[2,3-b]pyridin-1-yl]propane-1-sulfonate |
| SMILES | CCCCCC[n+]1cccc2c1N=C(/C=C/C=C1/N(CCCS(=O)(=O)[O-])c3ncccc3C1(C)C)C2(C)C |
| InChI | InChI=1S/C30H40N4O3S/c1-6-7-8-9-19-33-20-12-15-24-28(33)32-25(29(24,2)3)16-10-17-26-30(4,5)23-14-11-18-31-27(23)34(26)21-13-22-38(35,36)37/h10-12,14-18,20H,6-9,13,19,21-22H2,1-5H3 |
| InChIKey | LXEYCEGJCKOUKG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 89.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.74 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|