C23H35N5O2 — CID 59073682
6-(3-ethyl-4-methylanilino)-3-[5-(pyrrolidin-3-ylmethylamino)pentyl]-1H-pyrimidine-2,4-dione (PubChem CID 59073682) has the molecular formula C23H35N5O2 and a molecular weight of 413.57 g/mol. Its IUPAC name is 6-(3-ethyl-4-methylanilino)-3-[5-(pyrrolidin-3-ylmethylamino)pentyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(3-ethyl-4-methylanilino)-3-[5-(pyrrolidin-3-ylmethylamino)pentyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 59073682 |
| Molecular Formula | C23H35N5O2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | 6-(3-ethyl-4-methylanilino)-3-[5-(pyrrolidin-3-ylmethylamino)pentyl]-1H-pyrimidine-2,4-dione |
| SMILES | CCc1cc(Nc2cc(=O)n(CCCCCNCC3CCNC3)c(=O)[nH]2)ccc1C |
| InChI | InChI=1S/C23H35N5O2/c1-3-19-13-20(8-7-17(19)2)26-21-14-22(29)28(23(30)27-21)12-6-4-5-10-24-15-18-9-11-25-16-18/h7-8,13-14,18,24-26H,3-6,9-12,15-16H2,1-2H3,(H,27,30) |
| InChIKey | OGQYVUKEUWJDOB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|