C25H25ClN2O4S — CID 59073812
4-[[[3-[(2-chlorophenyl)methyl]phenyl]sulfonylamino]methyl]-N-[(2S)-1-oxobutan-2-yl]benzamide (PubChem CID 59073812) has the molecular formula C25H25ClN2O4S and a molecular weight of 485.01 g/mol. Its IUPAC name is 4-[[[3-[(2-chlorophenyl)methyl]phenyl]sulfonylamino]methyl]-N-[(2S)-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[[[3-[(2-chlorophenyl)methyl]phenyl]sulfonylamino]methyl]-N-[(2S)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 59073812 |
| Molecular Formula | C25H25ClN2O4S |
| Molecular Weight | 485.01 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 4-[[[3-[(2-chlorophenyl)methyl]phenyl]sulfonylamino]methyl]-N-[(2S)-1-oxobutan-2-yl]benzamide |
| SMILES | CC[C@@H](C=O)NC(=O)c1ccc(CNS(=O)(=O)c2cccc(Cc3ccccc3Cl)c2)cc1 |
| InChI | InChI=1S/C25H25ClN2O4S/c1-2-22(17-29)28-25(30)20-12-10-18(11-13-20)16-27-33(31,32)23-8-5-6-19(15-23)14-21-7-3-4-9-24(21)26/h3-13,15,17,22,27H,2,14,16H2,1H3,(H,28,30)/t22-/m0/s1 |
| InChIKey | ZCQNIWQORSIUOC-QFIPXVFZSA-N |
| XLogP | 4.12 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.01 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|