C24H22Cl2N2O5S — CID 59073721
4-[[[4-(3,5-dichlorophenoxy)phenyl]sulfonylamino]methyl]-N-[(2S)-1-oxobutan-2-yl]benzamide (PubChem CID 59073721) has the molecular formula C24H22Cl2N2O5S and a molecular weight of 521.42 g/mol. Its IUPAC name is 4-[[[4-(3,5-dichlorophenoxy)phenyl]sulfonylamino]methyl]-N-[(2S)-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[[[4-(3,5-dichlorophenoxy)phenyl]sulfonylamino]methyl]-N-[(2S)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 59073721 |
| Molecular Formula | C24H22Cl2N2O5S |
| Molecular Weight | 521.42 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | 4-[[[4-(3,5-dichlorophenoxy)phenyl]sulfonylamino]methyl]-N-[(2S)-1-oxobutan-2-yl]benzamide |
| SMILES | CC[C@@H](C=O)NC(=O)c1ccc(CNS(=O)(=O)c2ccc(Oc3cc(Cl)cc(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C24H22Cl2N2O5S/c1-2-20(15-29)28-24(30)17-5-3-16(4-6-17)14-27-34(31,32)23-9-7-21(8-10-23)33-22-12-18(25)11-19(26)13-22/h3-13,15,20,27H,2,14H2,1H3,(H,28,30)/t20-/m0/s1 |
| InChIKey | FRGZHVQSXLUPFT-FQEVSTJZSA-N |
| XLogP | 4.97 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|