About (2S)-4-hydroxypyrrolidin-1-ide-2-carboxylic acid;praseodymium
(2S)-4-hydroxypyrrolidin-1-ide-2-carboxylic acid;praseodymium (PubChem CID 59074395) has the molecular formula C5H8NO3Pr-
and a molecular weight of 271.03 g/mol. Its IUPAC name is (2S)-4-hydroxypyrrolidin-1-ide-2-carboxylic acid;praseodymium.
Molecular Properties
| Compound Name | (2S)-4-hydroxypyrrolidin-1-ide-2-carboxylic acid;praseodymium |
| PubChem CID | 59074395 |
| Molecular Formula | C5H8NO3Pr- |
| Molecular Weight | 271.03 g/mol |
| Exact Mass | 270.96 |
| IUPAC Name | (2S)-4-hydroxypyrrolidin-1-ide-2-carboxylic acid;praseodymium |
| SMILES | O=C(O)[C@@H]1CC(O)C[N-]1.[Pr] |
| InChI | InChI=1S/C5H8NO3.Pr/c7-3-1-4(5(8)9)6-2-3;/h3-4,7H,1-2H2,(H,8,9);/q-1;/t3?,4-;/m0./s1 |
| InChIKey | MOTNLCFTWJXSOE-LXNQBTANSA-N |
| XLogP | -0.42 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.03 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-4-hydroxypyrrolidin-1-ide-2-carboxylic acid;praseodymium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-hydroxypyrrolidin-1-ide-2-carboxylic acid;praseodymium?
The IUPAC name of (2S)-4-hydroxypyrrolidin-1-ide-2-carboxylic acid;praseodymium (CID 59074395) is (2S)-4-hydroxypyrrolidin-1-ide-2-carboxylic acid;praseodymium.
What is the SMILES notation for (2S)-4-hydroxypyrrolidin-1-ide-2-carboxylic acid;praseodymium?
The canonical SMILES for (2S)-4-hydroxypyrrolidin-1-ide-2-carboxylic acid;praseodymium is O=C(O)[C@@H]1CC(O)C[N-]1.[Pr].
What is the InChIKey of (2S)-4-hydroxypyrrolidin-1-ide-2-carboxylic acid;praseodymium?
The InChIKey is MOTNLCFTWJXSOE-LXNQBTANSA-N. The full InChI is InChI=1S/C5H8NO3.Pr/c7-3-1-4(5(8)9)6-2-3;/h3-4,7H,1-2H2,(H,8,9);/q-1;/t3?,4-;/m0./s1.
What are the key properties of (2S)-4-hydroxypyrrolidin-1-ide-2-carboxylic acid;praseodymium?
(2S)-4-hydroxypyrrolidin-1-ide-2-carboxylic acid;praseodymium has a molecular weight of 271.03 g/mol, XLogP of -0.42, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-hydroxypyrrolidin-1-ide-2-carboxylic acid;praseodymium is sourced from PubChem (CID 59074395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).