About iridium;pyrrolidin-1-ide-2-carboxylic acid
iridium;pyrrolidin-1-ide-2-carboxylic acid (PubChem CID 58958811) has the molecular formula C5H8IrNO2-
and a molecular weight of 306.34 g/mol. Its IUPAC name is iridium;pyrrolidin-1-ide-2-carboxylic acid.
Molecular Properties
| Compound Name | iridium;pyrrolidin-1-ide-2-carboxylic acid |
| PubChem CID | 58958811 |
| Molecular Formula | C5H8IrNO2- |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | iridium;pyrrolidin-1-ide-2-carboxylic acid |
| SMILES | O=C(O)C1CCC[N-]1.[Ir] |
| InChI | InChI=1S/C5H8NO2.Ir/c7-5(8)4-2-1-3-6-4;/h4H,1-3H2,(H,7,8);/q-1; |
| InChIKey | ISHOISBDTVEPJH-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 51.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze iridium;pyrrolidin-1-ide-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;pyrrolidin-1-ide-2-carboxylic acid?
The IUPAC name of iridium;pyrrolidin-1-ide-2-carboxylic acid (CID 58958811) is iridium;pyrrolidin-1-ide-2-carboxylic acid.
What is the SMILES notation for iridium;pyrrolidin-1-ide-2-carboxylic acid?
The canonical SMILES for iridium;pyrrolidin-1-ide-2-carboxylic acid is O=C(O)C1CCC[N-]1.[Ir].
What is the InChIKey of iridium;pyrrolidin-1-ide-2-carboxylic acid?
The InChIKey is ISHOISBDTVEPJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8NO2.Ir/c7-5(8)4-2-1-3-6-4;/h4H,1-3H2,(H,7,8);/q-1;.
What are the key properties of iridium;pyrrolidin-1-ide-2-carboxylic acid?
iridium;pyrrolidin-1-ide-2-carboxylic acid has a molecular weight of 306.34 g/mol, XLogP of 0.60, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;pyrrolidin-1-ide-2-carboxylic acid is sourced from PubChem (CID 58958811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).