About platinum(2+);propanedioic acid;[(2S)-pyrrolidin-1-id-2-yl]methylazanide
platinum(2+);propanedioic acid;[(2S)-pyrrolidin-1-id-2-yl]methylazanide (PubChem CID 59892941) has the molecular formula C8H14N2O4Pt
and a molecular weight of 397.29 g/mol. Its IUPAC name is platinum(2+);propanedioic acid;[(2S)-pyrrolidin-1-id-2-yl]methylazanide.
Molecular Properties
| Compound Name | platinum(2+);propanedioic acid;[(2S)-pyrrolidin-1-id-2-yl]methylazanide |
| PubChem CID | 59892941 |
| Molecular Formula | C8H14N2O4Pt |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | platinum(2+);propanedioic acid;[(2S)-pyrrolidin-1-id-2-yl]methylazanide |
| SMILES | O=C(O)CC(=O)O.[NH-]C[C@@H]1CCC[N-]1.[Pt+2] |
| InChI | InChI=1S/C5H10N2.C3H4O4.Pt/c6-4-5-2-1-3-7-5;4-2(5)1-3(6)7;/h5-6H,1-4H2;1H2,(H,4,5)(H,6,7);/q-2;;+2/t5-;;/m0../s1 |
| InChIKey | JUEDSJGZHBDCIE-XRIGFGBMSA-N |
| XLogP | 1.12 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze platinum(2+);propanedioic acid;[(2S)-pyrrolidin-1-id-2-yl]methylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of platinum(2+);propanedioic acid;[(2S)-pyrrolidin-1-id-2-yl]methylazanide?
The IUPAC name of platinum(2+);propanedioic acid;[(2S)-pyrrolidin-1-id-2-yl]methylazanide (CID 59892941) is platinum(2+);propanedioic acid;[(2S)-pyrrolidin-1-id-2-yl]methylazanide.
What is the SMILES notation for platinum(2+);propanedioic acid;[(2S)-pyrrolidin-1-id-2-yl]methylazanide?
The canonical SMILES for platinum(2+);propanedioic acid;[(2S)-pyrrolidin-1-id-2-yl]methylazanide is O=C(O)CC(=O)O.[NH-]C[C@@H]1CCC[N-]1.[Pt+2].
What is the InChIKey of platinum(2+);propanedioic acid;[(2S)-pyrrolidin-1-id-2-yl]methylazanide?
The InChIKey is JUEDSJGZHBDCIE-XRIGFGBMSA-N. The full InChI is InChI=1S/C5H10N2.C3H4O4.Pt/c6-4-5-2-1-3-7-5;4-2(5)1-3(6)7;/h5-6H,1-4H2;1H2,(H,4,5)(H,6,7);/q-2;;+2/t5-;;/m0../s1.
What are the key properties of platinum(2+);propanedioic acid;[(2S)-pyrrolidin-1-id-2-yl]methylazanide?
platinum(2+);propanedioic acid;[(2S)-pyrrolidin-1-id-2-yl]methylazanide has a molecular weight of 397.29 g/mol, XLogP of 1.12, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for platinum(2+);propanedioic acid;[(2S)-pyrrolidin-1-id-2-yl]methylazanide is sourced from PubChem (CID 59892941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).