About dichloroiron;piperidin-1-ide-2-carboxylate;piperidin-1-ide-2-carboxylic acid
dichloroiron;piperidin-1-ide-2-carboxylate;piperidin-1-ide-2-carboxylic acid (PubChem CID 5247736) has the molecular formula C12H19Cl2FeN2O4-3
and a molecular weight of 382.05 g/mol. Its IUPAC name is dichloroiron;piperidin-1-ide-2-carboxylate;piperidin-1-ide-2-carboxylic acid.
Molecular Properties
| Compound Name | dichloroiron;piperidin-1-ide-2-carboxylate;piperidin-1-ide-2-carboxylic acid |
| PubChem CID | 5247736 |
| Molecular Formula | C12H19Cl2FeN2O4-3 |
| Molecular Weight | 382.05 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | dichloroiron;piperidin-1-ide-2-carboxylate;piperidin-1-ide-2-carboxylic acid |
| SMILES | Cl[Fe]Cl.O=C(O)C1CCCC[N-]1.O=C([O-])C1CCCC[N-]1 |
| InChI | InChI=1S/2C6H10NO2.2ClH.Fe/c2*8-6(9)5-3-1-2-4-7-5;;;/h2*5H,1-4H2,(H,8,9);2*1H;/q2*-1;;;+2/p-3 |
| InChIKey | DHUMEBAPLUJATQ-UHFFFAOYSA-K |
| XLogP | 2.04 |
| TPSA | 105.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.05 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dichloroiron;piperidin-1-ide-2-carboxylate;piperidin-1-ide-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroiron;piperidin-1-ide-2-carboxylate;piperidin-1-ide-2-carboxylic acid?
The IUPAC name of dichloroiron;piperidin-1-ide-2-carboxylate;piperidin-1-ide-2-carboxylic acid (CID 5247736) is dichloroiron;piperidin-1-ide-2-carboxylate;piperidin-1-ide-2-carboxylic acid.
What is the SMILES notation for dichloroiron;piperidin-1-ide-2-carboxylate;piperidin-1-ide-2-carboxylic acid?
The canonical SMILES for dichloroiron;piperidin-1-ide-2-carboxylate;piperidin-1-ide-2-carboxylic acid is Cl[Fe]Cl.O=C(O)C1CCCC[N-]1.O=C([O-])C1CCCC[N-]1.
What is the InChIKey of dichloroiron;piperidin-1-ide-2-carboxylate;piperidin-1-ide-2-carboxylic acid?
The InChIKey is DHUMEBAPLUJATQ-UHFFFAOYSA-K. The full InChI is InChI=1S/2C6H10NO2.2ClH.Fe/c2*8-6(9)5-3-1-2-4-7-5;;;/h2*5H,1-4H2,(H,8,9);2*1H;/q2*-1;;;+2/p-3.
What are the key properties of dichloroiron;piperidin-1-ide-2-carboxylate;piperidin-1-ide-2-carboxylic acid?
dichloroiron;piperidin-1-ide-2-carboxylate;piperidin-1-ide-2-carboxylic acid has a molecular weight of 382.05 g/mol, XLogP of 2.04, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroiron;piperidin-1-ide-2-carboxylate;piperidin-1-ide-2-carboxylic acid is sourced from PubChem (CID 5247736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).