C13H26O8 — CID 59076217
2-[2-hydroxyethoxy-[(2S,4S,5R)-4-methoxy-5-(methoxymethyl)-2-methyloxolan-3-yl]oxymethoxy]ethanol (PubChem CID 59076217) has the molecular formula C13H26O8 and a molecular weight of 310.34 g/mol. Its IUPAC name is 2-[2-hydroxyethoxy-[(2S,4S,5R)-4-methoxy-5-(methoxymethyl)-2-methyloxolan-3-yl]oxymethoxy]ethanol.
| Compound Name | 2-[2-hydroxyethoxy-[(2S,4S,5R)-4-methoxy-5-(methoxymethyl)-2-methyloxolan-3-yl]oxymethoxy]ethanol |
|---|---|
| PubChem CID | 59076217 |
| Molecular Formula | C13H26O8 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 2-[2-hydroxyethoxy-[(2S,4S,5R)-4-methoxy-5-(methoxymethyl)-2-methyloxolan-3-yl]oxymethoxy]ethanol |
| SMILES | COC[C@H]1O[C@@H](C)C(OC(OCCO)OCCO)[C@H]1OC |
| InChI | InChI=1S/C13H26O8/c1-9-11(12(17-3)10(20-9)8-16-2)21-13(18-6-4-14)19-7-5-15/h9-15H,4-8H2,1-3H3/t9-,10+,11?,12-/m0/s1 |
| InChIKey | WYDJYWQSCURSGE-MBYGNEARSA-N |
| XLogP | -0.88 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|