C10H18O4 — CID 139492004
3-ethenoxy-4-methoxy-2-(methoxymethyl)-5-methyloxolane (PubChem CID 139492004) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is 3-ethenoxy-4-methoxy-2-(methoxymethyl)-5-methyloxolane.
| Compound Name | 3-ethenoxy-4-methoxy-2-(methoxymethyl)-5-methyloxolane |
|---|---|
| PubChem CID | 139492004 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 3-ethenoxy-4-methoxy-2-(methoxymethyl)-5-methyloxolane |
| SMILES | C=COC1C(COC)OC(C)C1OC |
| InChI | InChI=1S/C10H18O4/c1-5-13-10-8(6-11-3)14-7(2)9(10)12-4/h5,7-10H,1,6H2,2-4H3 |
| InChIKey | GFIRYSPMVVDQKM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|