C8H12O — CID 59077256
(1S,2R,5S)-2-methylbicyclo[3.2.0]heptan-3-one (PubChem CID 59077256) has the molecular formula C8H12O and a molecular weight of 124.18 g/mol. Its IUPAC name is (1S,2R,5S)-2-methylbicyclo[3.2.0]heptan-3-one.
| Compound Name | (1S,2R,5S)-2-methylbicyclo[3.2.0]heptan-3-one |
|---|---|
| PubChem CID | 59077256 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | (1S,2R,5S)-2-methylbicyclo[3.2.0]heptan-3-one |
| SMILES | C[C@H]1C(=O)C[C@@H]2CC[C@@H]21 |
| InChI | InChI=1S/C8H12O/c1-5-7-3-2-6(7)4-8(5)9/h5-7H,2-4H2,1H3/t5-,6+,7-/m1/s1 |
| InChIKey | QJTYAYIYTVIMJZ-DSYKOEDSSA-N |
| XLogP | 1.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |