C17H18ClFN4O4S3 — CID 59077456
(2Z)-N-[(6R,7R)-2-acetyl-3-methylsulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-(5-chloro-2-methyl-1,3-thiazol-4-yl)-2-(2-fluoroethoxyimino)acetamide (PubChem CID 59077456) has the molecular formula C17H18ClFN4O4S3 and a molecular weight of 493.01 g/mol. Its IUPAC name is (2Z)-N-[(6R,7R)-2-acetyl-3-methylsulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-(5-chloro-2-methyl-1,3-thiazol-4-yl)-2-(2-fluoroethoxyimino)acetamide.
| Compound Name | (2Z)-N-[(6R,7R)-2-acetyl-3-methylsulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-(5-chloro-2-methyl-1,3-thiazol-4-yl)-2-(2-fluoroethoxyimino)acetamide |
|---|---|
| PubChem CID | 59077456 |
| Molecular Formula | C17H18ClFN4O4S3 |
| Molecular Weight | 493.01 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | (2Z)-N-[(6R,7R)-2-acetyl-3-methylsulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-(5-chloro-2-methyl-1,3-thiazol-4-yl)-2-(2-fluoroethoxyimino)acetamide |
| SMILES | CSC1=C(C(C)=O)N2C(=O)[C@@H](NC(=O)/C(=N\OCCF)c3nc(C)sc3Cl)[C@H]2SC1 |
| InChI | InChI=1S/C17H18ClFN4O4S3/c1-7(24)13-9(28-3)6-29-17-12(16(26)23(13)17)21-15(25)11(22-27-5-4-19)10-14(18)30-8(2)20-10/h12,17H,4-6H2,1-3H3,(H,21,25)/b22-11-/t12-,17-/m1/s1 |
| InChIKey | AVHWSUXLTQEONL-PZIUZVFCSA-N |
| XLogP | 2.36 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.01 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|