C31H54O7 — CID 59078402
(3R,4S,5S,6R,9R,11E,13S,14R)-13,14-diethyl-4,13-dihydroxy-3,5,7,7,9,11-hexamethyl-6-[(3R,4S,6R)-3,4,6-trimethyloxan-2-yl]oxy-1-oxacyclotetradec-11-ene-2,10-dione (PubChem CID 59078402) has the molecular formula C31H54O7 and a molecular weight of 538.77 g/mol. Its IUPAC name is (3R,4S,5S,6R,9R,11E,13S,14R)-13,14-diethyl-4,13-dihydroxy-3,5,7,7,9,11-hexamethyl-6-[(3R,4S,6R)-3,4,6-trimethyloxan-2-yl]oxy-1-oxacyclotetradec-11-ene-2,10-dione.
| Compound Name | (3R,4S,5S,6R,9R,11E,13S,14R)-13,14-diethyl-4,13-dihydroxy-3,5,7,7,9,11-hexamethyl-6-[(3R,4S,6R)-3,4,6-trimethyloxan-2-yl]oxy-1-oxacyclotetradec-11-ene-2,10-dione |
|---|---|
| PubChem CID | 59078402 |
| Molecular Formula | C31H54O7 |
| Molecular Weight | 538.77 g/mol |
| Exact Mass | 538.39 |
| IUPAC Name | (3R,4S,5S,6R,9R,11E,13S,14R)-13,14-diethyl-4,13-dihydroxy-3,5,7,7,9,11-hexamethyl-6-[(3R,4S,6R)-3,4,6-trimethyloxan-2-yl]oxy-1-oxacyclotetradec-11-ene-2,10-dione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O)[C@H](C)[C@@H](OC2O[C@H](C)C[C@H](C)[C@H]2C)C(C)(C)C[C@@H](C)C(=O)/C(C)=C/[C@@]1(O)CC |
| InChI | InChI=1S/C31H54O7/c1-12-24-31(35,13-2)16-19(5)25(32)18(4)15-30(10,11)27(22(8)26(33)23(9)28(34)37-24)38-29-21(7)17(3)14-20(6)36-29/h16-18,20-24,26-27,29,33,35H,12-15H2,1-11H3/b19-16+/t17-,18+,20+,21+,22-,23+,24+,26-,27+,29?,31-/m0/s1 |
| InChIKey | XCQQLVAOTFDQQO-BTXOPONSSA-N |
| XLogP | 5.46 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.77 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |