C33H56N2O8 — CID 90991041
[(2R,3S,7R,10R,11R,13R)-2-ethyl-5,7,9,9,11,13-hexamethyl-6,12,14-trioxo-10-[(3R,4S,6R)-3,4,6-trimethyloxan-2-yl]oxy-1-oxacyclotetradec-4-en-3-yl] N-[(2S)-2-aminopropyl]carbamate (PubChem CID 90991041) has the molecular formula C33H56N2O8 and a molecular weight of 608.82 g/mol. Its IUPAC name is [(2R,3S,7R,10R,11R,13R)-2-ethyl-5,7,9,9,11,13-hexamethyl-6,12,14-trioxo-10-[(3R,4S,6R)-3,4,6-trimethyloxan-2-yl]oxy-1-oxacyclotetradec-4-en-3-yl] N-[(2S)-2-aminopropyl]carbamate.
| Compound Name | [(2R,3S,7R,10R,11R,13R)-2-ethyl-5,7,9,9,11,13-hexamethyl-6,12,14-trioxo-10-[(3R,4S,6R)-3,4,6-trimethyloxan-2-yl]oxy-1-oxacyclotetradec-4-en-3-yl] N-[(2S)-2-aminopropyl]carbamate |
|---|---|
| PubChem CID | 90991041 |
| Molecular Formula | C33H56N2O8 |
| Molecular Weight | 608.82 g/mol |
| Exact Mass | 608.40 |
| IUPAC Name | [(2R,3S,7R,10R,11R,13R)-2-ethyl-5,7,9,9,11,13-hexamethyl-6,12,14-trioxo-10-[(3R,4S,6R)-3,4,6-trimethyloxan-2-yl]oxy-1-oxacyclotetradec-4-en-3-yl] N-[(2S)-2-aminopropyl]carbamate |
| SMILES | CC[C@H]1OC(=O)[C@H](C)C(=O)[C@H](C)[C@@H](OC2O[C@H](C)C[C@H](C)[C@H]2C)C(C)(C)C[C@@H](C)C(=O)C(C)=C[C@@H]1OC(=O)NC[C@H](C)N |
| InChI | InChI=1S/C33H56N2O8/c1-12-25-26(42-32(39)35-16-20(5)34)14-18(3)27(36)19(4)15-33(10,11)29(23(8)28(37)24(9)30(38)41-25)43-31-22(7)17(2)13-21(6)40-31/h14,17,19-26,29,31H,12-13,15-16,34H2,1-11H3,(H,35,39)/t17-,19+,20-,21+,22+,23-,24+,25+,26-,29+,31?/m0/s1 |
| InChIKey | UQLVKBYYVNBMOK-VBZDSXITSA-N |
| XLogP | 4.97 |
| TPSA | 143.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.82 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|