C22H29BN2O2 — CID 59079910
N-[6-[(4-ethanimidoylphenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]-N-ethyl-methylboronamidic acid (PubChem CID 59079910) has the molecular formula C22H29BN2O2 and a molecular weight of 364.30 g/mol. Its IUPAC name is N-[6-[(4-ethanimidoylphenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]-N-ethyl-methylboronamidic acid.
| Compound Name | N-[6-[(4-ethanimidoylphenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]-N-ethyl-methylboronamidic acid |
|---|---|
| PubChem CID | 59079910 |
| Molecular Formula | C22H29BN2O2 |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | N-[6-[(4-ethanimidoylphenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]-N-ethyl-methylboronamidic acid |
| SMILES | [H]/N=C(\C)c1ccc(COc2ccc3c(c2)CCC(N(CC)B(C)O)C3)cc1 |
| InChI | InChI=1S/C22H29BN2O2/c1-4-25(23(3)26)21-11-9-20-14-22(12-10-19(20)13-21)27-15-17-5-7-18(8-6-17)16(2)24/h5-8,10,12,14,21,24,26H,4,9,11,13,15H2,1-3H3/b24-16+ |
| InChIKey | ZORFXTAYHMVOMN-LFVJCYFKSA-N |
| XLogP | 3.94 |
| TPSA | 56.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|