C17H15N3O9S — CID 59080227
2-[3-methyl-5-[2-[3-methyl-5-(trioxidanylsulfanyl)-1,3-benzoxazol-2-ylidene]ethylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]acetic acid (PubChem CID 59080227) has the molecular formula C17H15N3O9S and a molecular weight of 437.39 g/mol. Its IUPAC name is 2-[3-methyl-5-[2-[3-methyl-5-(trioxidanylsulfanyl)-1,3-benzoxazol-2-ylidene]ethylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]acetic acid.
| Compound Name | 2-[3-methyl-5-[2-[3-methyl-5-(trioxidanylsulfanyl)-1,3-benzoxazol-2-ylidene]ethylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]acetic acid |
|---|---|
| PubChem CID | 59080227 |
| Molecular Formula | C17H15N3O9S |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | 2-[3-methyl-5-[2-[3-methyl-5-(trioxidanylsulfanyl)-1,3-benzoxazol-2-ylidene]ethylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]acetic acid |
| SMILES | CN1C(=O)C(=CC=C2Oc3ccc(SOOO)cc3N2C)C(=O)N(CC(=O)O)C1=O |
| InChI | InChI=1S/C17H15N3O9S/c1-18-11-7-9(30-29-28-26)3-5-12(11)27-13(18)6-4-10-15(23)19(2)17(25)20(16(10)24)8-14(21)22/h3-7,26H,8H2,1-2H3,(H,21,22) |
| InChIKey | KEOBBKTZXBZLAE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 146.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|