C15H20O3S — CID 59083873
(4-tert-butyl-2-methyl-6-sulfanylphenyl) 3-oxobutanoate (PubChem CID 59083873) has the molecular formula C15H20O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is (4-tert-butyl-2-methyl-6-sulfanylphenyl) 3-oxobutanoate.
| Compound Name | (4-tert-butyl-2-methyl-6-sulfanylphenyl) 3-oxobutanoate |
|---|---|
| PubChem CID | 59083873 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (4-tert-butyl-2-methyl-6-sulfanylphenyl) 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)Oc1c(C)cc(C(C)(C)C)cc1S |
| InChI | InChI=1S/C15H20O3S/c1-9-6-11(15(3,4)5)8-12(19)14(9)18-13(17)7-10(2)16/h6,8,19H,7H2,1-5H3 |
| InChIKey | DQFQVMIENXCQOO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|