C17H26O6 — CID 67234914
butane;(4-tert-butyl-2-carboxyoxy-6-methylphenyl) hydrogen carbonate (PubChem CID 67234914) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is butane;(4-tert-butyl-2-carboxyoxy-6-methylphenyl) hydrogen carbonate.
| Compound Name | butane;(4-tert-butyl-2-carboxyoxy-6-methylphenyl) hydrogen carbonate |
|---|---|
| PubChem CID | 67234914 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | butane;(4-tert-butyl-2-carboxyoxy-6-methylphenyl) hydrogen carbonate |
| SMILES | CCCC.Cc1cc(C(C)(C)C)cc(OC(=O)O)c1OC(=O)O |
| InChI | InChI=1S/C13H16O6.C4H10/c1-7-5-8(13(2,3)4)6-9(18-11(14)15)10(7)19-12(16)17;1-3-4-2/h5-6H,1-4H3,(H,14,15)(H,16,17);3-4H2,1-2H3 |
| InChIKey | UNBMCIXXYYLFGJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|