C16H15ClF3N3O3 — CID 59085845
ethyl 2-[5-chloro-2-[[2,2-difluoro-2-(1-oxidopyridin-1-ium-2-yl)ethyl]amino]-3-fluoro-4-pyridinyl]acetate (PubChem CID 59085845) has the molecular formula C16H15ClF3N3O3 and a molecular weight of 389.76 g/mol. Its IUPAC name is ethyl 2-[5-chloro-2-[[2,2-difluoro-2-(1-oxidopyridin-1-ium-2-yl)ethyl]amino]-3-fluoro-4-pyridinyl]acetate.
| Compound Name | ethyl 2-[5-chloro-2-[[2,2-difluoro-2-(1-oxidopyridin-1-ium-2-yl)ethyl]amino]-3-fluoro-4-pyridinyl]acetate |
|---|---|
| PubChem CID | 59085845 |
| Molecular Formula | C16H15ClF3N3O3 |
| Molecular Weight | 389.76 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | ethyl 2-[5-chloro-2-[[2,2-difluoro-2-(1-oxidopyridin-1-ium-2-yl)ethyl]amino]-3-fluoro-4-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1c(Cl)cnc(NCC(F)(F)c2cccc[n+]2[O-])c1F |
| InChI | InChI=1S/C16H15ClF3N3O3/c1-2-26-13(24)7-10-11(17)8-21-15(14(10)18)22-9-16(19,20)12-5-3-4-6-23(12)25/h3-6,8H,2,7,9H2,1H3,(H,21,22) |
| InChIKey | JVKSXKJARBCYBI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.76 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|