C28H38B2FN10O5P2S2+ — CID 59087095
CID 59087095 (PubChem CID 59087095) has the molecular formula C28H38B2FN10O5P2S2+ and a molecular weight of 761.38 g/mol.
| Compound Name | CID 59087095 |
|---|---|
| PubChem CID | 59087095 |
| Molecular Formula | C28H38B2FN10O5P2S2+ |
| Molecular Weight | 761.38 g/mol |
| Exact Mass | 761.21 |
| IUPAC Name | — |
| SMILES | [B]P(C)OC(=O)C1=C(C[n+]2cccc(N(CCCN(C)C)P([B])C)c2N=CC)CSC2C(NC(=O)/C(=N\OCF)c3nsc(NC)n3)C(=O)N12 |
| InChI | InChI=1S/C28H37B2FN10O5P2S2/c1-7-33-23-18(40(47(5)29)13-9-11-38(3)4)10-8-12-39(23)14-17-15-49-26-20(25(43)41(26)21(17)27(44)46-48(6)30)34-24(42)19(36-45-16-31)22-35-28(32-2)50-37-22/h7-8,10,12,20,26H,9,11,13-16H2,1-6H3,(H-,32,34,35,37,42)/p+1/b36-19- |
| InChIKey | VRMJNLYFMSKRQF-WBIBEUCMSA-O |
| XLogP | 2.11 |
| TPSA | 157.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|