C15H9F3NS+ — CID 59087660
8-(trifluoromethyl)-11H-[1]benzothiolo[2,3-a]indolizin-10-ium (PubChem CID 59087660) has the molecular formula C15H9F3NS+ and a molecular weight of 292.31 g/mol. Its IUPAC name is 8-(trifluoromethyl)-11H-[1]benzothiolo[2,3-a]indolizin-10-ium.
| Compound Name | 8-(trifluoromethyl)-11H-[1]benzothiolo[2,3-a]indolizin-10-ium |
|---|---|
| PubChem CID | 59087660 |
| Molecular Formula | C15H9F3NS+ |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 8-(trifluoromethyl)-11H-[1]benzothiolo[2,3-a]indolizin-10-ium |
| SMILES | FC(F)(F)c1ccc2[n+](c1)Cc1c-2sc2ccccc12 |
| InChI | InChI=1S/C15H9F3NS/c16-15(17,18)9-5-6-12-14-11(8-19(12)7-9)10-3-1-2-4-13(10)20-14/h1-7H,8H2/q+1 |
| InChIKey | YXVZJEHRDGLDSQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|