C28H39N3O4 — CID 59090622
tert-butyl N-[(2S)-4-[(cyclopentylideneamino)-[(4-methoxyphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 59090622) has the molecular formula C28H39N3O4 and a molecular weight of 481.64 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-[(cyclopentylideneamino)-[(4-methoxyphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-[(cyclopentylideneamino)-[(4-methoxyphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 59090622 |
| Molecular Formula | C28H39N3O4 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | tert-butyl N-[(2S)-4-[(cyclopentylideneamino)-[(4-methoxyphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | COc1ccc(CN(CC(O)[C@H](Cc2ccccc2)NC(=O)OC(C)(C)C)N=C2CCCC2)cc1 |
| InChI | InChI=1S/C28H39N3O4/c1-28(2,3)35-27(33)29-25(18-21-10-6-5-7-11-21)26(32)20-31(30-23-12-8-9-13-23)19-22-14-16-24(34-4)17-15-22/h5-7,10-11,14-17,25-26,32H,8-9,12-13,18-20H2,1-4H3,(H,29,33)/t25-,26?/m0/s1 |
| InChIKey | GAHGDJSSZKOJQI-PMCHYTPCSA-N |
| XLogP | 4.92 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|