C27H32N4O4 — CID 59973941
tert-butyl N-[(2S)-4-[[(Z)-2-cyano-2-isocyanoethenyl]-[(4-methoxyphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 59973941) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-[[(Z)-2-cyano-2-isocyanoethenyl]-[(4-methoxyphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-[[(Z)-2-cyano-2-isocyanoethenyl]-[(4-methoxyphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 59973941 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | tert-butyl N-[(2S)-4-[[(Z)-2-cyano-2-isocyanoethenyl]-[(4-methoxyphenyl)methyl]amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | [C-]#[N+]/C(C#N)=C\N(Cc1ccc(OC)cc1)CC(O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H32N4O4/c1-27(2,3)35-26(33)30-24(15-20-9-7-6-8-10-20)25(32)19-31(18-22(16-28)29-4)17-21-11-13-23(34-5)14-12-21/h6-14,18,24-25,32H,15,17,19H2,1-3,5H3,(H,30,33)/b22-18-/t24-,25?/m0/s1 |
| InChIKey | AXPDDGBIJHOPNP-UVQMILGGSA-N |
| XLogP | 4.28 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|